C17H14N2OS2 — CID 56977414
1H-indol-3-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone (PubChem CID 56977414) has the molecular formula C17H14N2OS2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 1H-indol-3-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone.
| Compound Name | 1H-indol-3-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone |
|---|---|
| PubChem CID | 56977414 |
| Molecular Formula | C17H14N2OS2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1H-indol-3-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)C1CSC(c2cccnc2)S1 |
| InChI | InChI=1S/C17H14N2OS2/c20-16(13-9-19-14-6-2-1-5-12(13)14)15-10-21-17(22-15)11-4-3-7-18-8-11/h1-9,15,17,19H,10H2 |
| InChIKey | NZSDPGRYVHOLKO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |