C17H14N2OS2 — CID 57171973
indol-1-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone (PubChem CID 57171973) has the molecular formula C17H14N2OS2 and a molecular weight of 326.45 g/mol. Its IUPAC name is indol-1-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone.
| Compound Name | indol-1-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone |
|---|---|
| PubChem CID | 57171973 |
| Molecular Formula | C17H14N2OS2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | indol-1-yl-(2-pyridin-3-yl-1,3-dithiolan-4-yl)methanone |
| SMILES | O=C(C1CSC(c2cccnc2)S1)n1ccc2ccccc21 |
| InChI | InChI=1S/C17H14N2OS2/c20-16(19-9-7-12-4-1-2-6-14(12)19)15-11-21-17(22-15)13-5-3-8-18-10-13/h1-10,15,17H,11H2 |
| InChIKey | IVWLCTIMWVTBMK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |