C8H10O2S — CID 56979203
4-ethylsulfanylbenzene-1,2-diol (PubChem CID 56979203) has the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. Its IUPAC name is 4-ethylsulfanylbenzene-1,2-diol.
| Compound Name | 4-ethylsulfanylbenzene-1,2-diol |
|---|---|
| PubChem CID | 56979203 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 4-ethylsulfanylbenzene-1,2-diol |
| SMILES | CCSc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H10O2S/c1-2-11-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
| InChIKey | OHDBXDABUQUCEX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|