C26H34ClNO6Si — CID 56979769
[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2S)-7-chloro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl] 2-oxopent-4-enoate (PubChem CID 56979769) has the molecular formula C26H34ClNO6Si and a molecular weight of 520.10 g/mol. Its IUPAC name is [(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2S)-7-chloro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl] 2-oxopent-4-enoate.
| Compound Name | [(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2S)-7-chloro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl] 2-oxopent-4-enoate |
|---|---|
| PubChem CID | 56979769 |
| Molecular Formula | C26H34ClNO6Si |
| Molecular Weight | 520.10 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | [(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2S)-7-chloro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl] 2-oxopent-4-enoate |
| SMILES | C=CCC(=O)C(=O)ON1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H]1CCc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C26H34ClNO6Si/c1-8-9-20(29)25(32)33-28-22(18-13-11-16-10-12-17(27)14-19(16)23(18)30)21(24(28)31)15(2)34-35(6,7)26(3,4)5/h8,10,12,14-15,18,21-22H,1,9,11,13H2,2-7H3/t15-,18+,21-,22-/m1/s1 |
| InChIKey | PZWHSCCECCNSGV-ZOIWCPRRSA-N |
| XLogP | 4.93 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.10 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|