C22H23NO7 — CID 57296132
[(3S,4R)-3-[(1R)-1-acetyloxyethyl]-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate (PubChem CID 57296132) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is [(3S,4R)-3-[(1R)-1-acetyloxyethyl]-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate.
| Compound Name | [(3S,4R)-3-[(1R)-1-acetyloxyethyl]-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate |
|---|---|
| PubChem CID | 57296132 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [(3S,4R)-3-[(1R)-1-acetyloxyethyl]-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate |
| SMILES | C=CCC(=O)C(=O)ON1C(=O)[C@H]([C@@H](C)OC(C)=O)[C@H]1[C@H]1CCc2ccccc2C1=O |
| InChI | InChI=1S/C22H23NO7/c1-4-7-17(25)22(28)30-23-19(18(21(23)27)12(2)29-13(3)24)16-11-10-14-8-5-6-9-15(14)20(16)26/h4-6,8-9,12,16,18-19H,1,7,10-11H2,2-3H3/t12-,16-,18-,19-/m1/s1 |
| InChIKey | LZSYTJJVPGHARF-BYIJLXJXSA-N |
| XLogP | 1.81 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|