C28H37NO8Si — CID 57291041
methyl (7R)-7-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxopent-4-enoyloxy)azetidin-2-yl]-8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylate (PubChem CID 57291041) has the molecular formula C28H37NO8Si and a molecular weight of 543.69 g/mol. Its IUPAC name is methyl (7R)-7-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxopent-4-enoyloxy)azetidin-2-yl]-8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylate.
| Compound Name | methyl (7R)-7-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxopent-4-enoyloxy)azetidin-2-yl]-8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 57291041 |
| Molecular Formula | C28H37NO8Si |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | methyl (7R)-7-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-(2-oxopent-4-enoyloxy)azetidin-2-yl]-8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylate |
| SMILES | C=CCC(=O)C(=O)ON1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1[C@H]1CCc2ccc(C(=O)OC)cc2C1=O |
| InChI | InChI=1S/C28H37NO8Si/c1-9-10-21(30)27(34)36-29-23(22(25(29)32)16(2)37-38(7,8)28(3,4)5)19-14-13-17-11-12-18(26(33)35-6)15-20(17)24(19)31/h9,11-12,15-16,19,22-23H,1,10,13-14H2,2-8H3/t16-,19-,22-,23-/m1/s1 |
| InChIKey | XXKYBDYGRFNAKT-BGACZQCLSA-N |
| XLogP | 4.06 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|