C24H35NO5Si — CID 139265819
[3-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-oxocyclohexyl] benzoate (PubChem CID 139265819) has the molecular formula C24H35NO5Si and a molecular weight of 445.63 g/mol. Its IUPAC name is [3-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-oxocyclohexyl] benzoate.
| Compound Name | [3-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-oxocyclohexyl] benzoate |
|---|---|
| PubChem CID | 139265819 |
| Molecular Formula | C24H35NO5Si |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [3-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-oxocyclohexyl] benzoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)NC1C1CCCC(OC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C24H35NO5Si/c1-15(30-31(5,6)24(2,3)4)19-20(25-22(19)27)17-13-10-14-18(21(17)26)29-23(28)16-11-8-7-9-12-16/h7-9,11-12,15,17-20H,10,13-14H2,1-6H3,(H,25,27)/t15-,17?,18?,19-,20?/m1/s1 |
| InChIKey | ANCQZVUFAYNPCT-RWNDACCDSA-N |
| XLogP | 4.11 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|