C25H37NO7Si — CID 59248969
benzyl 4-acetyloxy-2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobutanoate (PubChem CID 59248969) has the molecular formula C25H37NO7Si and a molecular weight of 491.66 g/mol. Its IUPAC name is benzyl 4-acetyloxy-2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobutanoate.
| Compound Name | benzyl 4-acetyloxy-2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 59248969 |
| Molecular Formula | C25H37NO7Si |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | benzyl 4-acetyloxy-2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobutanoate |
| SMILES | CC(=O)OCC(=O)C(C)(C(=O)OCc1ccccc1)C1NC(=O)C1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37NO7Si/c1-16(33-34(7,8)24(3,4)5)20-21(26-22(20)29)25(6,19(28)15-31-17(2)27)23(30)32-14-18-12-10-9-11-13-18/h9-13,16,20-21H,14-15H2,1-8H3,(H,26,29)/t16-,20?,21?,25?/m1/s1 |
| InChIKey | FYQPQAXYHLWHPA-AECCHWAESA-N |
| XLogP | 3.39 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|