C26H35NO6Si — CID 57242816
[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2S)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate (PubChem CID 57242816) has the molecular formula C26H35NO6Si and a molecular weight of 485.65 g/mol. Its IUPAC name is [(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2S)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate.
| Compound Name | [(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2S)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate |
|---|---|
| PubChem CID | 57242816 |
| Molecular Formula | C26H35NO6Si |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(2S)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]azetidin-1-yl] 2-oxopent-4-enoate |
| SMILES | C=CCC(=O)C(=O)ON1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H]1CCc2ccccc2C1=O |
| InChI | InChI=1S/C26H35NO6Si/c1-8-11-20(28)25(31)32-27-22(19-15-14-17-12-9-10-13-18(17)23(19)29)21(24(27)30)16(2)33-34(6,7)26(3,4)5/h8-10,12-13,16,19,21-22H,1,11,14-15H2,2-7H3/t16-,19+,21-,22-/m1/s1 |
| InChIKey | VCSDLRDDQZNBDI-DGEVVOEJSA-N |
| XLogP | 4.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|