C26H34FNO6Si — CID 139612988
prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-5-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetate (PubChem CID 139612988) has the molecular formula C26H34FNO6Si and a molecular weight of 503.64 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-5-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetate.
| Compound Name | prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-5-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 139612988 |
| Molecular Formula | C26H34FNO6Si |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | prop-2-enyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(2R)-5-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetate |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1[C@H]1CCc2c(F)cccc2C1=O |
| InChI | InChI=1S/C26H34FNO6Si/c1-8-14-33-25(32)24(31)28-21(18-13-12-16-17(22(18)29)10-9-11-19(16)27)20(23(28)30)15(2)34-35(6,7)26(3,4)5/h8-11,15,18,20-21H,1,12-14H2,2-7H3/t15-,18-,20-,21-/m1/s1 |
| InChIKey | SSFCYNALSXSMHU-ZQYQINFJSA-N |
| XLogP | 4.06 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|