C21H26FNO6Si — CID 67808088
2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-7-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetic acid (PubChem CID 67808088) has the molecular formula C21H26FNO6Si and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-7-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-7-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67808088 |
| Molecular Formula | C21H26FNO6Si |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-7-fluoro-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-4-oxoazetidin-1-yl]-2-oxoacetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)N(C(=O)C(=O)O)[C@@H]1[C@H]1CCc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C21H26FNO6Si/c1-21(2,3)30(4,5)29-17-15(23(18(17)25)19(26)20(27)28)13-9-7-11-6-8-12(22)10-14(11)16(13)24/h6,8,10,13,15,17H,7,9H2,1-5H3,(H,27,28)/t13-,15-,17+/m1/s1 |
| InChIKey | KWDRIAAROXXEPS-UNEWFSDZSA-N |
| XLogP | 2.78 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|