C23H29NO4Si — CID 57127928
prop-2-enyl (10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2(7),3,5-tetraene-3-carboxylate (PubChem CID 57127928) has the molecular formula C23H29NO4Si and a molecular weight of 411.57 g/mol. Its IUPAC name is prop-2-enyl (10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2(7),3,5-tetraene-3-carboxylate.
| Compound Name | prop-2-enyl (10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2(7),3,5-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 57127928 |
| Molecular Formula | C23H29NO4Si |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | prop-2-enyl (10R,11R,12S)-13-oxo-12-[(1R)-1-trimethylsilyloxyethyl]-14-azatetracyclo[8.5.0.02,7.011,14]pentadeca-1(15),2(7),3,5-tetraene-3-carboxylate |
| SMILES | C=CCOC(=O)c1cccc2c1C1=CN3C(=O)[C@H]([C@@H](C)O[Si](C)(C)C)[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C23H29NO4Si/c1-6-12-27-23(26)17-9-7-8-15-10-11-16-18(20(15)17)13-24-21(16)19(22(24)25)14(2)28-29(3,4)5/h6-9,13-14,16,19,21H,1,10-12H2,2-5H3/t14-,16-,19-,21-/m1/s1 |
| InChIKey | ZZBSPNJSHSNXGK-WHIZCHOSSA-N |
| XLogP | 4.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|