About CID 56982429
CID 56982429 (PubChem CID 56982429) has the molecular formula C28H22BO2
and a molecular weight of 401.29 g/mol.
Molecular Properties
| Compound Name | CID 56982429 |
| PubChem CID | 56982429 |
| Molecular Formula | C28H22BO2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | — |
| SMILES | [B](Oc1ccc(C=Cc2ccccc2)cc1)Oc1ccc(C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H22BO2/c1-3-7-23(8-4-1)11-13-25-15-19-27(20-16-25)30-29-31-28-21-17-26(18-22-28)14-12-24-9-5-2-6-10-24/h1-22H |
| InChIKey | KOHGBWYDVCVAPK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 56982429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56982429?
The IUPAC name of CID 56982429 (CID 56982429) is not available.
What is the SMILES notation for CID 56982429?
The canonical SMILES for CID 56982429 is [B](Oc1ccc(C=Cc2ccccc2)cc1)Oc1ccc(C=Cc2ccccc2)cc1.
What is the InChIKey of CID 56982429?
The InChIKey is KOHGBWYDVCVAPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22BO2/c1-3-7-23(8-4-1)11-13-25-15-19-27(20-16-25)30-29-31-28-21-17-26(18-22-28)14-12-24-9-5-2-6-10-24/h1-22H.
What are the key properties of CID 56982429?
CID 56982429 has a molecular weight of 401.29 g/mol, XLogP of 7.02, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56982429 is sourced from PubChem (CID 56982429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).