C15H31NO4 — CID 56983577
4,4-bis(2-methoxyethoxy)-2,2,6,6-tetramethylpiperidine (PubChem CID 56983577) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4,4-bis(2-methoxyethoxy)-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4,4-bis(2-methoxyethoxy)-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 56983577 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 4,4-bis(2-methoxyethoxy)-2,2,6,6-tetramethylpiperidine |
| SMILES | COCCOC1(OCCOC)CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H31NO4/c1-13(2)11-15(19-9-7-17-5,20-10-8-18-6)12-14(3,4)16-13/h16H,7-12H2,1-6H3 |
| InChIKey | NUEHOAAXOQGROC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|