C18H36N2O2 — CID 546965
4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 546965) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 546965 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)(C2(O)CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C18H36N2O2/c1-13(2)9-17(21,10-14(3,4)19-13)18(22)11-15(5,6)20-16(7,8)12-18/h19-22H,9-12H2,1-8H3 |
| InChIKey | IKHZFOJLDVTJDA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |