C13H24N2O3 — CID 674434
(4R)-4-hydroxy-3,4,7,7,9,9-hexamethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 674434) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is (4R)-4-hydroxy-3,4,7,7,9,9-hexamethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (4R)-4-hydroxy-3,4,7,7,9,9-hexamethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 674434 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (4R)-4-hydroxy-3,4,7,7,9,9-hexamethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | CN1C(=O)OC2(CC(C)(C)NC(C)(C)C2)[C@@]1(C)O |
| InChI | InChI=1S/C13H24N2O3/c1-10(2)7-13(8-11(3,4)14-10)12(5,17)15(6)9(16)18-13/h14,17H,7-8H2,1-6H3/t12-/m1/s1 |
| InChIKey | SVBLLSQZYQNSJW-GFCCVEGCSA-N |
| XLogP | 1.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |