C21H34N2O3 — CID 98056495
(4S,5R)-5-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-hydroxy-4,5-dimethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-oxazolidin-2-one (PubChem CID 98056495) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is (4S,5R)-5-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-hydroxy-4,5-dimethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-hydroxy-4,5-dimethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 98056495 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (4S,5R)-5-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-hydroxy-4,5-dimethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-oxazolidin-2-one |
| SMILES | CC1(C)CC(N2C(=O)O[C@](C)([C@@H]3C[C@H]4C=C[C@H]3C4)[C@]2(C)O)CC(C)(C)N1 |
| InChI | InChI=1S/C21H34N2O3/c1-18(2)11-15(12-19(3,4)22-18)23-17(24)26-20(5,21(23,6)25)16-10-13-7-8-14(16)9-13/h7-8,13-16,22,25H,9-12H2,1-6H3/t13-,14-,16+,20+,21-/m0/s1 |
| InChIKey | SDQQXVQAAOQUIZ-VGTPPEPASA-N |
| XLogP | 3.43 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|