C13H21N5O — CID 138059223
6-methylidene-5-(2,2,6,6-tetramethylpiperidin-4-yl)imino-1,2,4-triazin-3-one (PubChem CID 138059223) has the molecular formula C13H21N5O and a molecular weight of 263.35 g/mol. Its IUPAC name is 6-methylidene-5-(2,2,6,6-tetramethylpiperidin-4-yl)imino-1,2,4-triazin-3-one.
| Compound Name | 6-methylidene-5-(2,2,6,6-tetramethylpiperidin-4-yl)imino-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 138059223 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 6-methylidene-5-(2,2,6,6-tetramethylpiperidin-4-yl)imino-1,2,4-triazin-3-one |
| SMILES | C=C1N=NC(=O)N/C1=N/C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H21N5O/c1-8-10(15-11(19)17-16-8)14-9-6-12(2,3)18-13(4,5)7-9/h9,18H,1,6-7H2,2-5H3,(H,14,15,19) |
| InChIKey | MUNMAKQRDNYPIA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|