C16H26N4O — CID 178188763
3-cyclododecylimino-6-methylidene-1,2,4-triazin-5-one (PubChem CID 178188763) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-cyclododecylimino-6-methylidene-1,2,4-triazin-5-one.
| Compound Name | 3-cyclododecylimino-6-methylidene-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 178188763 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-cyclododecylimino-6-methylidene-1,2,4-triazin-5-one |
| SMILES | C=C1N=N/C(=N/C2CCCCCCCCCCC2)NC1=O |
| InChI | InChI=1S/C16H26N4O/c1-13-15(21)18-16(20-19-13)17-14-11-9-7-5-3-2-4-6-8-10-12-14/h14H,1-12H2,(H,17,18,21) |
| InChIKey | LKZNACNVBVDXDJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|