C13H21O3P — CID 10083727
2-(2-bicyclo[2.2.1]hept-5-enyl)-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 10083727) has the molecular formula C13H21O3P and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 10083727 |
| Molecular Formula | C13H21O3P |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CC1(C)OP(=O)(C2CC3C=CC2C3)OC1(C)C |
| InChI | InChI=1S/C13H21O3P/c1-12(2)13(3,4)16-17(14,15-12)11-8-9-5-6-10(11)7-9/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | UUJAOBUKVCOGHA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|