C21H41N3O3+2 — CID 6960429
(4S)-4-hydroxy-4,7,7,9,9-pentamethyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one (PubChem CID 6960429) has the molecular formula C21H41N3O3+2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (4S)-4-hydroxy-4,7,7,9,9-pentamethyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one.
| Compound Name | (4S)-4-hydroxy-4,7,7,9,9-pentamethyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 6960429 |
| Molecular Formula | C21H41N3O3+2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.31 |
| IUPAC Name | (4S)-4-hydroxy-4,7,7,9,9-pentamethyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
| SMILES | CC1(C)CC(N2C(=O)OC3(CC(C)(C)[NH2+]C(C)(C)C3)[C@]2(C)O)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C21H39N3O3/c1-16(2)10-14(11-17(3,4)22-16)24-15(25)27-21(20(24,9)26)12-18(5,6)23-19(7,8)13-21/h14,22-23,26H,10-13H2,1-9H3/p+2/t20-/m0/s1 |
| InChIKey | UYCDKYYLWWFWGU-FQEVSTJZSA-P |
| XLogP | 1.08 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |