C15H24O5 — CID 56984303
2-methylpropyl 1-hydroxy-6-(2-methylpropoxy)-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 56984303) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-methylpropyl 1-hydroxy-6-(2-methylpropoxy)-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | 2-methylpropyl 1-hydroxy-6-(2-methylpropoxy)-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 56984303 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-methylpropyl 1-hydroxy-6-(2-methylpropoxy)-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | CC(C)COC(=O)C1(O)C=CC(=O)CC1OCC(C)C |
| InChI | InChI=1S/C15H24O5/c1-10(2)8-19-13-7-12(16)5-6-15(13,18)14(17)20-9-11(3)4/h5-6,10-11,13,18H,7-9H2,1-4H3 |
| InChIKey | IBNOFNUJRPQNGT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |