C18H26NO2+ — CID 56985757
propyl (1R,3S,4R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate (PubChem CID 56985757) has the molecular formula C18H26NO2+ and a molecular weight of 288.41 g/mol. Its IUPAC name is propyl (1R,3S,4R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate.
| Compound Name | propyl (1R,3S,4R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate |
|---|---|
| PubChem CID | 56985757 |
| Molecular Formula | C18H26NO2+ |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | propyl (1R,3S,4R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate |
| SMILES | CCCOC(=O)[C@@H]1C[N@@+]2(C(C)c3ccccc3)CC[C@H]1C2 |
| InChI | InChI=1S/C18H26NO2/c1-3-11-21-18(20)17-13-19(10-9-16(17)12-19)14(2)15-7-5-4-6-8-15/h4-8,14,16-17H,3,9-13H2,1-2H3/q+1/t14?,16-,17+,19+/m0/s1 |
| InChIKey | UMXLQGQTKFABST-TVFOMDLUSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|