C18H26NO2+ — CID 854102
[(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenylbutanoate (PubChem CID 854102) has the molecular formula C18H26NO2+ and a molecular weight of 288.41 g/mol. Its IUPAC name is [(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenylbutanoate.
| Compound Name | [(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenylbutanoate |
|---|---|
| PubChem CID | 854102 |
| Molecular Formula | C18H26NO2+ |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)O[C@@H]1C[N+]2(C)CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C18H26NO2/c1-3-16(14-7-5-4-6-8-14)18(20)21-17-13-19(2)11-9-15(17)10-12-19/h4-8,15-17H,3,9-13H2,1-2H3/q+1/t15?,16-,17+,19?/m0/s1 |
| InChIKey | UTBRXKLTFZQNMV-DHADLLTHSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|