C22H33IN2O2 — CID 139674509
(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[cyclohexyl(phenyl)methyl]carbamate iodide (PubChem CID 139674509) has the molecular formula C22H33IN2O2 and a molecular weight of 484.42 g/mol. Its IUPAC name is (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[cyclohexyl(phenyl)methyl]carbamate iodide.
| Compound Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[cyclohexyl(phenyl)methyl]carbamate iodide |
|---|---|
| PubChem CID | 139674509 |
| Molecular Formula | C22H33IN2O2 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[cyclohexyl(phenyl)methyl]carbamate iodide |
| SMILES | C[N+]12CCC(CC1)C(OC(=O)NC(c1ccccc1)C1CCCCC1)C2.[I-] |
| InChI | InChI=1S/C22H32N2O2.HI/c1-24-14-12-17(13-15-24)20(16-24)26-22(25)23-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2,4-5,8-9,17,19-21H,3,6-7,10-16H2,1H3;1H |
| InChIKey | OXFJDWBUDGOFEZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|