About (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate
(1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate (PubChem CID 87880519) has the molecular formula C22H34NO2+
and a molecular weight of 344.52 g/mol. Its IUPAC name is (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate.
Molecular Properties
| Compound Name | (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate |
| PubChem CID | 87880519 |
| Molecular Formula | C22H34NO2+ |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OC1C[N+]2(Cc3ccccc3)CCC1CC2 |
| InChI | InChI=1S/C22H34NO2/c1-3-5-11-19(4-2)22(24)25-21-17-23(14-12-20(21)13-15-23)16-18-9-7-6-8-10-18/h6-10,19-21H,3-5,11-17H2,1-2H3/q+1 |
| InChIKey | IEODVJJJFYQEDY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate?
The IUPAC name of (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate (CID 87880519) is (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate.
What is the SMILES notation for (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate?
The canonical SMILES for (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate is CCCCC(CC)C(=O)OC1C[N+]2(Cc3ccccc3)CCC1CC2.
What is the InChIKey of (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate?
The InChIKey is IEODVJJJFYQEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34NO2/c1-3-5-11-19(4-2)22(24)25-21-17-23(14-12-20(21)13-15-23)16-18-9-7-6-8-10-18/h6-10,19-21H,3-5,11-17H2,1-2H3/q+1.
What are the key properties of (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate?
(1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate has a molecular weight of 344.52 g/mol, XLogP of 4.56, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-ethylhexanoate is sourced from PubChem (CID 87880519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).