C17H24NO2+ — CID 22843484
ethyl (1S,3R,4S)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate (PubChem CID 22843484) has the molecular formula C17H24NO2+ and a molecular weight of 274.38 g/mol. Its IUPAC name is ethyl (1S,3R,4S)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate.
| Compound Name | ethyl (1S,3R,4S)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate |
|---|---|
| PubChem CID | 22843484 |
| Molecular Formula | C17H24NO2+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | ethyl (1S,3R,4S)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.1]heptane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[N@+]2(C(C)c3ccccc3)CC[C@@H]1C2 |
| InChI | InChI=1S/C17H24NO2/c1-3-20-17(19)16-12-18(10-9-15(16)11-18)13(2)14-7-5-4-6-8-14/h4-8,13,15-16H,3,9-12H2,1-2H3/q+1/t13?,15-,16+,18+/m1/s1 |
| InChIKey | MVCAZGDRMUMASB-FISDYWJASA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|