C25H37F9N3O5+ — CID 56986828
tert-butyl N-[(2S)-3-methyl-1-[(2R)-2-methyl-1-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-ium-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 56986828) has the molecular formula C25H37F9N3O5+ and a molecular weight of 630.57 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-[(2R)-2-methyl-1-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-ium-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-[(2R)-2-methyl-1-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-ium-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 56986828 |
| Molecular Formula | C25H37F9N3O5+ |
| Molecular Weight | 630.57 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-[(2R)-2-methyl-1-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-ium-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)[N+]1(C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)CCC[C@H]1C)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H36F9N3O5/c1-12(2)15(17(38)22(26,27)23(28,29)24(30,31)25(32,33)34)35-19(40)37(11-9-10-14(37)5)18(39)16(13(3)4)36-20(41)42-21(6,7)8/h12-16H,9-11H2,1-8H3,(H-,35,36,40,41)/p+1/t14-,15?,16+,37?/m1/s1 |
| InChIKey | FXTYSKABTJUEQG-WEENWOEDSA-O |
| XLogP | 5.83 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|