C20H18FN2O2S- — CID 56989881
3-[3-[4-fluoro-3-(sulfinatoamino)phenyl]-2-phenylpropyl]pyridine (PubChem CID 56989881) has the molecular formula C20H18FN2O2S- and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-[3-[4-fluoro-3-(sulfinatoamino)phenyl]-2-phenylpropyl]pyridine.
| Compound Name | 3-[3-[4-fluoro-3-(sulfinatoamino)phenyl]-2-phenylpropyl]pyridine |
|---|---|
| PubChem CID | 56989881 |
| Molecular Formula | C20H18FN2O2S- |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-[3-[4-fluoro-3-(sulfinatoamino)phenyl]-2-phenylpropyl]pyridine |
| SMILES | O=S([O-])Nc1cc(CC(Cc2cccnc2)c2ccccc2)ccc1F |
| InChI | InChI=1S/C20H19FN2O2S/c21-19-9-8-15(13-20(19)23-26(24)25)11-18(17-6-2-1-3-7-17)12-16-5-4-10-22-14-16/h1-10,13-14,18,23H,11-12H2,(H,24,25)/p-1 |
| InChIKey | YWCPLTXFZDUCCD-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|