C17H29F4NO4S — CID 56991574
butyl 3,3,4,4-tetrafluoro-2-methylidene-4-(octylsulfonylamino)butanoate (PubChem CID 56991574) has the molecular formula C17H29F4NO4S and a molecular weight of 419.48 g/mol. Its IUPAC name is butyl 3,3,4,4-tetrafluoro-2-methylidene-4-(octylsulfonylamino)butanoate.
| Compound Name | butyl 3,3,4,4-tetrafluoro-2-methylidene-4-(octylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 56991574 |
| Molecular Formula | C17H29F4NO4S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | butyl 3,3,4,4-tetrafluoro-2-methylidene-4-(octylsulfonylamino)butanoate |
| SMILES | C=C(C(=O)OCCCC)C(F)(F)C(F)(F)NS(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C17H29F4NO4S/c1-4-6-8-9-10-11-13-27(24,25)22-17(20,21)16(18,19)14(3)15(23)26-12-7-5-2/h22H,3-13H2,1-2H3 |
| InChIKey | XAFZLYJFQSDWIL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|