C9H20N4S — CID 56991907
4-heptyl-2-sulfanyl-3H-1,2,4-triazol-3-amine (PubChem CID 56991907) has the molecular formula C9H20N4S and a molecular weight of 216.35 g/mol. Its IUPAC name is 4-heptyl-2-sulfanyl-3H-1,2,4-triazol-3-amine.
| Compound Name | 4-heptyl-2-sulfanyl-3H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 56991907 |
| Molecular Formula | C9H20N4S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-heptyl-2-sulfanyl-3H-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCN1C=NN(S)C1N |
| InChI | InChI=1S/C9H20N4S/c1-2-3-4-5-6-7-12-8-11-13(14)9(12)10/h8-9,14H,2-7,10H2,1H3 |
| InChIKey | NTEOBHJQBRDOBE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|