C9H19N3 — CID 69381874
4-butyl-3-ethyl-2-methyl-3H-1,2,4-triazole (PubChem CID 69381874) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-butyl-3-ethyl-2-methyl-3H-1,2,4-triazole.
| Compound Name | 4-butyl-3-ethyl-2-methyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69381874 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 4-butyl-3-ethyl-2-methyl-3H-1,2,4-triazole |
| SMILES | CCCCN1C=NN(C)C1CC |
| InChI | InChI=1S/C9H19N3/c1-4-6-7-12-8-10-11(3)9(12)5-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | QMLCHYWSPCTPHI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |