C11H23N3 — CID 69387208
2-butyl-3-ethyl-4-propan-2-yl-3H-1,2,4-triazole (PubChem CID 69387208) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 2-butyl-3-ethyl-4-propan-2-yl-3H-1,2,4-triazole.
| Compound Name | 2-butyl-3-ethyl-4-propan-2-yl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69387208 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 2-butyl-3-ethyl-4-propan-2-yl-3H-1,2,4-triazole |
| SMILES | CCCCN1N=CN(C(C)C)C1CC |
| InChI | InChI=1S/C11H23N3/c1-5-7-8-14-11(6-2)13(9-12-14)10(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | FOIOSUVUPWRHCJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |