C12H24FN3 — CID 87803672
3-butyl-4-fluoro-2-hexyl-3H-1,2,4-triazole (PubChem CID 87803672) has the molecular formula C12H24FN3 and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-butyl-4-fluoro-2-hexyl-3H-1,2,4-triazole.
| Compound Name | 3-butyl-4-fluoro-2-hexyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87803672 |
| Molecular Formula | C12H24FN3 |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 3-butyl-4-fluoro-2-hexyl-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN(F)C1CCCC |
| InChI | InChI=1S/C12H24FN3/c1-3-5-7-8-10-16-12(9-6-4-2)15(13)11-14-16/h11-12H,3-10H2,1-2H3 |
| InChIKey | FQOCJDSZKNADEZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|