C11H18F5N3 — CID 87806130
2-hexyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole (PubChem CID 87806130) has the molecular formula C11H18F5N3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-hexyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole.
| Compound Name | 2-hexyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87806130 |
| Molecular Formula | C11H18F5N3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-hexyl-3-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN(C(F)(F)C(F)(F)F)C1C |
| InChI | InChI=1S/C11H18F5N3/c1-3-4-5-6-7-19-9(2)18(8-17-19)11(15,16)10(12,13)14/h8-9H,3-7H2,1-2H3 |
| InChIKey | PCEBKRFQNMHPOY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|