C8H11Cl3F3N3 — CID 87804893
2-butyl-4-(trichloromethyl)-3-(trifluoromethyl)-3H-1,2,4-triazole (PubChem CID 87804893) has the molecular formula C8H11Cl3F3N3 and a molecular weight of 312.55 g/mol. Its IUPAC name is 2-butyl-4-(trichloromethyl)-3-(trifluoromethyl)-3H-1,2,4-triazole.
| Compound Name | 2-butyl-4-(trichloromethyl)-3-(trifluoromethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87804893 |
| Molecular Formula | C8H11Cl3F3N3 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-butyl-4-(trichloromethyl)-3-(trifluoromethyl)-3H-1,2,4-triazole |
| SMILES | CCCCN1N=CN(C(Cl)(Cl)Cl)C1C(F)(F)F |
| InChI | InChI=1S/C8H11Cl3F3N3/c1-2-3-4-17-6(7(12,13)14)16(5-15-17)8(9,10)11/h5-6H,2-4H2,1H3 |
| InChIKey | MAAXRTSEHBGZCA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|