C8H11Cl6N3 — CID 87804627
2-butyl-4-chloro-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole (PubChem CID 87804627) has the molecular formula C8H11Cl6N3 and a molecular weight of 361.92 g/mol. Its IUPAC name is 2-butyl-4-chloro-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole.
| Compound Name | 2-butyl-4-chloro-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87804627 |
| Molecular Formula | C8H11Cl6N3 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 358.91 |
| IUPAC Name | 2-butyl-4-chloro-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
| SMILES | CCCCN1N=CN(Cl)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H11Cl6N3/c1-2-3-4-17-6(16(14)5-15-17)7(9,10)8(11,12)13/h5-6H,2-4H2,1H3 |
| InChIKey | JBZIICRLBJGBOB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|