C7H11Cl3FN3 — CID 87804789
2-butyl-4-fluoro-3-(trichloromethyl)-3H-1,2,4-triazole (PubChem CID 87804789) has the molecular formula C7H11Cl3FN3 and a molecular weight of 262.54 g/mol. Its IUPAC name is 2-butyl-4-fluoro-3-(trichloromethyl)-3H-1,2,4-triazole.
| Compound Name | 2-butyl-4-fluoro-3-(trichloromethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87804789 |
| Molecular Formula | C7H11Cl3FN3 |
| Molecular Weight | 262.54 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 2-butyl-4-fluoro-3-(trichloromethyl)-3H-1,2,4-triazole |
| SMILES | CCCCN1N=CN(F)C1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H11Cl3FN3/c1-2-3-4-14-6(7(8,9)10)13(11)5-12-14/h5-6H,2-4H2,1H3 |
| InChIKey | FCMFLDZQZJHYBI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|