C13H22Cl5N3 — CID 69381652
2-butyl-4-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole (PubChem CID 69381652) has the molecular formula C13H22Cl5N3 and a molecular weight of 397.61 g/mol. Its IUPAC name is 2-butyl-4-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole.
| Compound Name | 2-butyl-4-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69381652 |
| Molecular Formula | C13H22Cl5N3 |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-butyl-4-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
| SMILES | CCCCN1N=CN(CC(C)(C)C)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H22Cl5N3/c1-5-6-7-21-10(12(14,15)13(16,17)18)20(9-19-21)8-11(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | LOVAHHMDLYSUFI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|