C14H29N3 — CID 69382894
2,4-dibutyl-3-tert-butyl-3H-1,2,4-triazole (PubChem CID 69382894) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 2,4-dibutyl-3-tert-butyl-3H-1,2,4-triazole.
| Compound Name | 2,4-dibutyl-3-tert-butyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69382894 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 2,4-dibutyl-3-tert-butyl-3H-1,2,4-triazole |
| SMILES | CCCCN1C=NN(CCCC)C1C(C)(C)C |
| InChI | InChI=1S/C14H29N3/c1-6-8-10-16-12-15-17(11-9-7-2)13(16)14(3,4)5/h12-13H,6-11H2,1-5H3 |
| InChIKey | BWEQNFQYXWBBOF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |