C16H33N3 — CID 69383042
3,4-ditert-butyl-2-hexyl-3H-1,2,4-triazole (PubChem CID 69383042) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is 3,4-ditert-butyl-2-hexyl-3H-1,2,4-triazole.
| Compound Name | 3,4-ditert-butyl-2-hexyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69383042 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | 3,4-ditert-butyl-2-hexyl-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C16H33N3/c1-8-9-10-11-12-19-14(15(2,3)4)18(13-17-19)16(5,6)7/h13-14H,8-12H2,1-7H3 |
| InChIKey | FJACTAJXTPQRRE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|