C12H24N4O2 — CID 69382853
3-tert-butyl-2-hexyl-4-nitro-3H-1,2,4-triazole (PubChem CID 69382853) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-tert-butyl-2-hexyl-4-nitro-3H-1,2,4-triazole.
| Compound Name | 3-tert-butyl-2-hexyl-4-nitro-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69382853 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-tert-butyl-2-hexyl-4-nitro-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN([N+](=O)[O-])C1C(C)(C)C |
| InChI | InChI=1S/C12H24N4O2/c1-5-6-7-8-9-14-11(12(2,3)4)15(10-13-14)16(17)18/h10-11H,5-9H2,1-4H3 |
| InChIKey | KVVXFYSJQVEGTI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|