C12H20Cl5N3 — CID 69386023
4-ethyl-2-hexyl-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole (PubChem CID 69386023) has the molecular formula C12H20Cl5N3 and a molecular weight of 383.58 g/mol. Its IUPAC name is 4-ethyl-2-hexyl-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole.
| Compound Name | 4-ethyl-2-hexyl-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69386023 |
| Molecular Formula | C12H20Cl5N3 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 4-ethyl-2-hexyl-3-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN(CC)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H20Cl5N3/c1-3-5-6-7-8-20-10(19(4-2)9-18-20)11(13,14)12(15,16)17/h9-10H,3-8H2,1-2H3 |
| InChIKey | HTFYYJFNBDYEHZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|