C9H15BrCl3N3 — CID 69386199
3-bromo-2-hexyl-4-(trichloromethyl)-3H-1,2,4-triazole (PubChem CID 69386199) has the molecular formula C9H15BrCl3N3 and a molecular weight of 351.50 g/mol. Its IUPAC name is 3-bromo-2-hexyl-4-(trichloromethyl)-3H-1,2,4-triazole.
| Compound Name | 3-bromo-2-hexyl-4-(trichloromethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69386199 |
| Molecular Formula | C9H15BrCl3N3 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 3-bromo-2-hexyl-4-(trichloromethyl)-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN(C(Cl)(Cl)Cl)C1Br |
| InChI | InChI=1S/C9H15BrCl3N3/c1-2-3-4-5-6-16-8(10)15(7-14-16)9(11,12)13/h7-8H,2-6H2,1H3 |
| InChIKey | OOKMOISQZNXQCR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|