C13H26ClN3 — CID 87804923
4-chloro-3-(2,2-dimethylpropyl)-2-hexyl-3H-1,2,4-triazole (PubChem CID 87804923) has the molecular formula C13H26ClN3 and a molecular weight of 259.82 g/mol. Its IUPAC name is 4-chloro-3-(2,2-dimethylpropyl)-2-hexyl-3H-1,2,4-triazole.
| Compound Name | 4-chloro-3-(2,2-dimethylpropyl)-2-hexyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87804923 |
| Molecular Formula | C13H26ClN3 |
| Molecular Weight | 259.82 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-chloro-3-(2,2-dimethylpropyl)-2-hexyl-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN(Cl)C1CC(C)(C)C |
| InChI | InChI=1S/C13H26ClN3/c1-5-6-7-8-9-17-12(10-13(2,3)4)16(14)11-15-17/h11-12H,5-10H2,1-4H3 |
| InChIKey | XZCKIZIVUBOMBC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|