C11H22ClN3 — CID 87804341
2-butyl-4-chloro-3-(2,2-dimethylpropyl)-3H-1,2,4-triazole (PubChem CID 87804341) has the molecular formula C11H22ClN3 and a molecular weight of 231.77 g/mol. Its IUPAC name is 2-butyl-4-chloro-3-(2,2-dimethylpropyl)-3H-1,2,4-triazole.
| Compound Name | 2-butyl-4-chloro-3-(2,2-dimethylpropyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87804341 |
| Molecular Formula | C11H22ClN3 |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-butyl-4-chloro-3-(2,2-dimethylpropyl)-3H-1,2,4-triazole |
| SMILES | CCCCN1N=CN(Cl)C1CC(C)(C)C |
| InChI | InChI=1S/C11H22ClN3/c1-5-6-7-15-10(8-11(2,3)4)14(12)9-13-15/h9-10H,5-8H2,1-4H3 |
| InChIKey | GDCAEWYSFRUXHX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|