C9H18ClN3 — CID 87803233
2-butyl-4-chloro-3-propan-2-yl-3H-1,2,4-triazole (PubChem CID 87803233) has the molecular formula C9H18ClN3 and a molecular weight of 203.72 g/mol. Its IUPAC name is 2-butyl-4-chloro-3-propan-2-yl-3H-1,2,4-triazole.
| Compound Name | 2-butyl-4-chloro-3-propan-2-yl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87803233 |
| Molecular Formula | C9H18ClN3 |
| Molecular Weight | 203.72 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-butyl-4-chloro-3-propan-2-yl-3H-1,2,4-triazole |
| SMILES | CCCCN1N=CN(Cl)C1C(C)C |
| InChI | InChI=1S/C9H18ClN3/c1-4-5-6-13-9(8(2)3)12(10)7-11-13/h7-9H,4-6H2,1-3H3 |
| InChIKey | JEKWJNXCHSDOQY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|