C14H29N3 — CID 69388534
2-hexyl-4-propan-2-yl-3-propyl-3H-1,2,4-triazole (PubChem CID 69388534) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 2-hexyl-4-propan-2-yl-3-propyl-3H-1,2,4-triazole.
| Compound Name | 2-hexyl-4-propan-2-yl-3-propyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69388534 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 2-hexyl-4-propan-2-yl-3-propyl-3H-1,2,4-triazole |
| SMILES | CCCCCCN1N=CN(C(C)C)C1CCC |
| InChI | InChI=1S/C14H29N3/c1-5-7-8-9-11-17-14(10-6-2)16(12-15-17)13(3)4/h12-14H,5-11H2,1-4H3 |
| InChIKey | QQOMWKCFGCVUFK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|