C9H15FN4 — CID 87804422
3-fluoro-2-hexyl-3H-1,2,4-triazole-4-carbonitrile (PubChem CID 87804422) has the molecular formula C9H15FN4 and a molecular weight of 198.24 g/mol. Its IUPAC name is 3-fluoro-2-hexyl-3H-1,2,4-triazole-4-carbonitrile.
| Compound Name | 3-fluoro-2-hexyl-3H-1,2,4-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 87804422 |
| Molecular Formula | C9H15FN4 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 3-fluoro-2-hexyl-3H-1,2,4-triazole-4-carbonitrile |
| SMILES | CCCCCCN1N=CN(C#N)C1F |
| InChI | InChI=1S/C9H15FN4/c1-2-3-4-5-6-14-9(10)13(7-11)8-12-14/h8-9H,2-6H2,1H3 |
| InChIKey | OXVZAOKSHDJDJO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|