C8H14N4 — CID 87804185
3-ethyl-2-propyl-3H-1,2,4-triazole-4-carbonitrile (PubChem CID 87804185) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 3-ethyl-2-propyl-3H-1,2,4-triazole-4-carbonitrile.
| Compound Name | 3-ethyl-2-propyl-3H-1,2,4-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 87804185 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 3-ethyl-2-propyl-3H-1,2,4-triazole-4-carbonitrile |
| SMILES | CCCN1N=CN(C#N)C1CC |
| InChI | InChI=1S/C8H14N4/c1-3-5-12-8(4-2)11(6-9)7-10-12/h7-8H,3-5H2,1-2H3 |
| InChIKey | XQKFJYVUUHOQLF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|